C28H30FN3O6 — CID 5155730
N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 5155730) has the molecular formula C28H30FN3O6 and a molecular weight of 523.56 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 5155730 |
| Molecular Formula | C28H30FN3O6 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)C(=O)CN(CC2CCCO2)C(=O)c2ccc(C)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C28H30FN3O6/c1-19-5-9-22(14-26(19)32(35)36)28(34)31(16-24-4-3-13-37-24)18-27(33)30(17-25-12-6-20(2)38-25)15-21-7-10-23(29)11-8-21/h5-12,14,24H,3-4,13,15-18H2,1-2H3 |
| InChIKey | DNAPLQKRZXXQDY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 106.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|