C29H34N4O6 — CID 3285718
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide (PubChem CID 3285718) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3285718 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(CCN2CCOCC2)C(=O)c2ccc(C)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C29H34N4O6/c1-22-8-10-25(18-27(22)33(36)37)29(35)31(13-12-30-14-16-38-17-15-30)21-28(34)32(19-24-6-4-3-5-7-24)20-26-11-9-23(2)39-26/h3-11,18H,12-17,19-21H2,1-2H3 |
| InChIKey | MYIMANYODXUOBX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|