C28H29N3O8 — CID 4117550
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4117550) has the molecular formula C28H29N3O8 and a molecular weight of 535.55 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4117550 |
| Molecular Formula | C28H29N3O8 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(CC(=O)N(Cc2ccc3c(c2)OCO3)Cc2ccco2)CC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H29N3O8/c1-19-6-8-21(13-24(19)31(34)35)28(33)30(16-23-5-3-11-37-23)17-27(32)29(15-22-4-2-10-36-22)14-20-7-9-25-26(12-20)39-18-38-25/h2,4,6-10,12-13,23H,3,5,11,14-18H2,1H3 |
| InChIKey | DPNWACGXFBHCKU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|