C21H27ClN2O4 — CID 42773072
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(2-methoxyethyl)propanamide (PubChem CID 42773072) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(2-methoxyethyl)propanamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 42773072 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-2-chloro-N-(2-methoxyethyl)propanamide |
| SMILES | COCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C(=O)C(C)Cl |
| InChI | InChI=1S/C21H27ClN2O4/c1-16-9-10-19(28-16)14-24(13-18-7-5-4-6-8-18)20(25)15-23(11-12-27-3)21(26)17(2)22/h4-10,17H,11-15H2,1-3H3 |
| InChIKey | UHTOQAYEEFESAM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|