C29H32N4O8 — CID 4135000
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide (PubChem CID 4135000) has the molecular formula C29H32N4O8 and a molecular weight of 564.60 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 4135000 |
| Molecular Formula | C29H32N4O8 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
| SMILES | O=C(CN(CCCN1CCOCC1)C(=O)c1ccc([N+](=O)[O-])cc1)N(Cc1ccc2c(c1)OCO2)Cc1ccco1 |
| InChI | InChI=1S/C29H32N4O8/c34-28(32(19-25-3-1-14-39-25)18-22-4-9-26-27(17-22)41-21-40-26)20-31(11-2-10-30-12-15-38-16-13-30)29(35)23-5-7-24(8-6-23)33(36)37/h1,3-9,14,17H,2,10-13,15-16,18-21H2 |
| InChIKey | RWWLQPATAYBFJJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|