C31H34N4O8 — CID 4094991
N-[2-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 4094991) has the molecular formula C31H34N4O8 and a molecular weight of 590.63 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4094991 |
| Molecular Formula | C31H34N4O8 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=O)CN(CCN2CCOCC2)C(=O)C=Cc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C31H34N4O8/c1-23-2-9-27(43-23)20-34(19-25-5-10-28-29(18-25)42-22-41-28)31(37)21-33(13-12-32-14-16-40-17-15-32)30(36)11-6-24-3-7-26(8-4-24)35(38)39/h2-11,18H,12-17,19-22H2,1H3 |
| InChIKey | RJHSJFPIDGREII-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|