C28H29N3O6S — CID 6113614
(E)-N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 6113614) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is (E)-N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6113614 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (E)-N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methylpropyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CC(C)CN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N3O6S/c1-20(2)15-29(27(32)12-8-21-5-9-23(10-6-21)31(34)35)18-28(33)30(17-24-4-3-13-38-24)16-22-7-11-25-26(14-22)37-19-36-25/h3-14,20H,15-19H2,1-2H3/b12-8+ |
| InChIKey | OWYICLMRTXUOBO-XYOKQWHBSA-N |
| XLogP | 5.11 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|