C29H33N3O4S — CID 92909438
(E)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2S)-2-methylbutyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 92909438) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is (E)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2S)-2-methylbutyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2S)-2-methylbutyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 92909438 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (E)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2S)-2-methylbutyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CC[C@H](C)CN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H33N3O4S/c1-4-22(2)18-30(28(33)17-13-24-11-14-26(15-12-24)32(35)36)21-29(34)31(19-25-8-6-5-7-9-25)20-27-16-10-23(3)37-27/h5-17,22H,4,18-21H2,1-3H3/b17-13+/t22-/m0/s1 |
| InChIKey | KLXPJJMFBCREAN-OEHGHSTBSA-N |
| XLogP | 6.08 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|