C22H29ClN2O2S — CID 7271354
(2R)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]-2-chloropropanamide (PubChem CID 7271354) has the molecular formula C22H29ClN2O2S and a molecular weight of 421.01 g/mol. Its IUPAC name is (2R)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]-2-chloropropanamide.
| Compound Name | (2R)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]-2-chloropropanamide |
|---|---|
| PubChem CID | 7271354 |
| Molecular Formula | C22H29ClN2O2S |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2R)-N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]-2-chloropropanamide |
| SMILES | CC[C@@H](C)N(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C22H29ClN2O2S/c1-5-16(2)25(22(27)18(4)23)15-21(26)24(13-19-9-7-6-8-10-19)14-20-12-11-17(3)28-20/h6-12,16,18H,5,13-15H2,1-4H3/t16-,18-/m1/s1 |
| InChIKey | SCNNIHLGPPYOBY-SJLPKXTDSA-N |
| XLogP | 4.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|