C26H31N3O2S — CID 5017970
N-benzyl-2-[benzylcarbamoyl(propan-2-yl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5017970) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is N-benzyl-2-[benzylcarbamoyl(propan-2-yl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[benzylcarbamoyl(propan-2-yl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5017970 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-benzyl-2-[benzylcarbamoyl(propan-2-yl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(C(=O)NCc2ccccc2)C(C)C)s1 |
| InChI | InChI=1S/C26H31N3O2S/c1-20(2)29(26(31)27-16-22-10-6-4-7-11-22)19-25(30)28(17-23-12-8-5-9-13-23)18-24-15-14-21(3)32-24/h4-15,20H,16-19H2,1-3H3,(H,27,31) |
| InChIKey | KBAFSZZWMHESNZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |