C27H33N3O2S — CID 4314524
N-benzyl-2-[benzylcarbamoyl(tert-butyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 4314524) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is N-benzyl-2-[benzylcarbamoyl(tert-butyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[benzylcarbamoyl(tert-butyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4314524 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-benzyl-2-[benzylcarbamoyl(tert-butyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(C(=O)NCc2ccccc2)C(C)(C)C)s1 |
| InChI | InChI=1S/C27H33N3O2S/c1-21-15-16-24(33-21)19-29(18-23-13-9-6-10-14-23)25(31)20-30(27(2,3)4)26(32)28-17-22-11-7-5-8-12-22/h5-16H,17-20H2,1-4H3,(H,28,32) |
| InChIKey | RCBCRZMSVHRGTF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |