C25H36N2O2S — CID 7416953
N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide (PubChem CID 7416953) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide.
| Compound Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 7416953 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)[C@H](C)CC |
| InChI | InChI=1S/C25H36N2O2S/c1-5-7-9-14-24(28)27(20(3)6-2)19-25(29)26(17-22-12-10-8-11-13-22)18-23-16-15-21(4)30-23/h8,10-13,15-16,20H,5-7,9,14,17-19H2,1-4H3/t20-/m1/s1 |
| InChIKey | FAGMRMCEONNEKM-HXUWFJFHSA-N |
| XLogP | 5.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|