C25H37N3O2 — CID 7216163
N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide (PubChem CID 7216163) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide.
| Compound Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 7216163 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N-[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-[(2R)-butan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)N(Cc1ccccc1)Cc1cccn1C)[C@H](C)CC |
| InChI | InChI=1S/C25H37N3O2/c1-5-7-9-16-24(29)28(21(3)6-2)20-25(30)27(18-22-13-10-8-11-14-22)19-23-15-12-17-26(23)4/h8,10-15,17,21H,5-7,9,16,18-20H2,1-4H3/t21-/m1/s1 |
| InChIKey | SMLOPGPDKDSZOX-OAQYLSRUSA-N |
| XLogP | 4.76 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|