C23H41N3O2 — CID 3502612
N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-yloctanamide (PubChem CID 3502612) has the molecular formula C23H41N3O2 and a molecular weight of 391.60 g/mol. Its IUPAC name is N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-yloctanamide.
| Compound Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-yloctanamide |
|---|---|
| PubChem CID | 3502612 |
| Molecular Formula | C23H41N3O2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-N-propan-2-yloctanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N(CCCC)Cc1cccn1C)C(C)C |
| InChI | InChI=1S/C23H41N3O2/c1-6-8-10-11-12-15-22(27)26(20(3)4)19-23(28)25(17-9-7-2)18-21-14-13-16-24(21)5/h13-14,16,20H,6-12,15,17-19H2,1-5H3 |
| InChIKey | ANMDISRZOUFWNZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|