C29H37N3O2 — CID 4317444
N-butan-2-yl-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 4317444) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-butan-2-yl-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 4317444 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-butan-2-yl-N-[2-[butyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | CCCCN(Cc1cccn1C)C(=O)CN(C(=O)c1ccc(-c2ccccc2)cc1)C(C)CC |
| InChI | InChI=1S/C29H37N3O2/c1-5-7-20-31(21-27-14-11-19-30(27)4)28(33)22-32(23(3)6-2)29(34)26-17-15-25(16-18-26)24-12-9-8-10-13-24/h8-19,23H,5-7,20-22H2,1-4H3 |
| InChIKey | HELWSPICYHNECT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |