C27H40N2O2S — CID 24717959
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-butan-2-yloctanamide (PubChem CID 24717959) has the molecular formula C27H40N2O2S and a molecular weight of 456.70 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-butan-2-yloctanamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-butan-2-yloctanamide |
|---|---|
| PubChem CID | 24717959 |
| Molecular Formula | C27H40N2O2S |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-butan-2-yloctanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(C)CC |
| InChI | InChI=1S/C27H40N2O2S/c1-5-7-8-9-13-16-26(30)29(23(4)6-2)21-27(31)28(19-24-14-11-10-12-15-24)20-25-22(3)17-18-32-25/h10-12,14-15,17-18,23H,5-9,13,16,19-21H2,1-4H3 |
| InChIKey | DZUFJXHSMZCCIP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|