C21H27ClN2O2S — CID 42777569
N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butan-2-yl-2-chloropropanamide (PubChem CID 42777569) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butan-2-yl-2-chloropropanamide.
| Compound Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butan-2-yl-2-chloropropanamide |
|---|---|
| PubChem CID | 42777569 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[2-[benzyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-N-butan-2-yl-2-chloropropanamide |
| SMILES | CCC(C)N(CC(=O)N(Cc1ccccc1)Cc1cccs1)C(=O)C(C)Cl |
| InChI | InChI=1S/C21H27ClN2O2S/c1-4-16(2)24(21(26)17(3)22)15-20(25)23(14-19-11-8-12-27-19)13-18-9-6-5-7-10-18/h5-12,16-17H,4,13-15H2,1-3H3 |
| InChIKey | FEWAAYGVGOAOAF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|