C30H33N3O4S — CID 3316680
N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 3316680) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3316680 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(C(=O)C=Cc2ccc([N+](=O)[O-])cc2)C2CCCCC2)s1 |
| InChI | InChI=1S/C30H33N3O4S/c1-23-12-18-28(38-23)21-31(20-25-8-4-2-5-9-25)30(35)22-32(26-10-6-3-7-11-26)29(34)19-15-24-13-16-27(17-14-24)33(36)37/h2,4-5,8-9,12-19,26H,3,6-7,10-11,20-22H2,1H3 |
| InChIKey | XNFMHTANXVMVCD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|