C16H17ClN2O6S — CID 42664623
4-chloro-N-(furan-2-ylmethyl)-3-nitro-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 42664623) has the molecular formula C16H17ClN2O6S and a molecular weight of 400.84 g/mol. Its IUPAC name is 4-chloro-N-(furan-2-ylmethyl)-3-nitro-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(furan-2-ylmethyl)-3-nitro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42664623 |
| Molecular Formula | C16H17ClN2O6S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4-chloro-N-(furan-2-ylmethyl)-3-nitro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N(Cc2ccco2)CC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C16H17ClN2O6S/c17-15-6-5-14(9-16(15)19(20)21)26(22,23)18(10-12-3-1-7-24-12)11-13-4-2-8-25-13/h1,3,5-7,9,13H,2,4,8,10-11H2 |
| InChIKey | CCSFUCKLKHQRKE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|