C20H27NO4S — CID 5224121
4-tert-butyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 5224121) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-tert-butyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5224121 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-tert-butyl-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(Cc2ccco2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-20(2,3)16-8-10-19(11-9-16)26(22,23)21(14-17-6-4-12-24-17)15-18-7-5-13-25-18/h4,6,8-12,18H,5,7,13-15H2,1-3H3 |
| InChIKey | PQLNOWQFOZGDTA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |