C24H28N2O5S — CID 94069364
3-cyclopentylidene-N-(furan-2-ylmethyl)-1-methyl-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]indole-5-sulfonamide (PubChem CID 94069364) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is 3-cyclopentylidene-N-(furan-2-ylmethyl)-1-methyl-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]indole-5-sulfonamide.
| Compound Name | 3-cyclopentylidene-N-(furan-2-ylmethyl)-1-methyl-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]indole-5-sulfonamide |
|---|---|
| PubChem CID | 94069364 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-cyclopentylidene-N-(furan-2-ylmethyl)-1-methyl-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]indole-5-sulfonamide |
| SMILES | CN1C(=O)C(=C2CCCC2)c2cc(S(=O)(=O)N(Cc3ccco3)C[C@H]3CCCO3)ccc21 |
| InChI | InChI=1S/C24H28N2O5S/c1-25-22-11-10-20(14-21(22)23(24(25)27)17-6-2-3-7-17)32(28,29)26(15-18-8-4-12-30-18)16-19-9-5-13-31-19/h4,8,10-12,14,19H,2-3,5-7,9,13,15-16H2,1H3/t19-/m1/s1 |
| InChIKey | UXHFVQUJRBNZBJ-LJQANCHMSA-N |
| XLogP | 3.95 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|