C17H20BrNO5S — CID 6618527
5-bromo-N-(furan-2-ylmethyl)-2-methoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 6618527) has the molecular formula C17H20BrNO5S and a molecular weight of 430.32 g/mol. Its IUPAC name is 5-bromo-N-(furan-2-ylmethyl)-2-methoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 5-bromo-N-(furan-2-ylmethyl)-2-methoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 6618527 |
| Molecular Formula | C17H20BrNO5S |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 5-bromo-N-(furan-2-ylmethyl)-2-methoxy-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C17H20BrNO5S/c1-22-16-7-6-13(18)10-17(16)25(20,21)19(11-14-4-2-8-23-14)12-15-5-3-9-24-15/h2,4,6-8,10,15H,3,5,9,11-12H2,1H3 |
| InChIKey | PDDZOCQPUJJTKI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |