C22H30N2O6S2 — CID 3192388
4-(azepan-1-ylsulfonyl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 3192388) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3192388 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(S(=O)(=O)N(Cc2ccco2)CC2CCCO2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H30N2O6S2/c25-31(26,23-13-3-1-2-4-14-23)21-9-11-22(12-10-21)32(27,28)24(17-19-7-5-15-29-19)18-20-8-6-16-30-20/h5,7,9-12,15,20H,1-4,6,8,13-14,16-18H2 |
| InChIKey | XPGRYRFGDFNVCM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |