C18H14Cl2N2O5S — CID 4792591
3,4-dichloro-N-(furan-2-ylmethyl)-N-[(4-nitrophenyl)methyl]benzenesulfonamide (PubChem CID 4792591) has the molecular formula C18H14Cl2N2O5S and a molecular weight of 441.29 g/mol. Its IUPAC name is 3,4-dichloro-N-(furan-2-ylmethyl)-N-[(4-nitrophenyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(furan-2-ylmethyl)-N-[(4-nitrophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4792591 |
| Molecular Formula | C18H14Cl2N2O5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 3,4-dichloro-N-(furan-2-ylmethyl)-N-[(4-nitrophenyl)methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(CN(Cc2ccco2)S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O5S/c19-17-8-7-16(10-18(17)20)28(25,26)21(12-15-2-1-9-27-15)11-13-3-5-14(6-4-13)22(23)24/h1-10H,11-12H2 |
| InChIKey | ZEUYXJMWBOPGOY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|