C21H16Cl2N2O2S — CID 2695360
N-benzyl-3,4-dichloro-N-[(2-cyanophenyl)methyl]benzenesulfonamide (PubChem CID 2695360) has the molecular formula C21H16Cl2N2O2S and a molecular weight of 431.34 g/mol. Its IUPAC name is N-benzyl-3,4-dichloro-N-[(2-cyanophenyl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-3,4-dichloro-N-[(2-cyanophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2695360 |
| Molecular Formula | C21H16Cl2N2O2S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | N-benzyl-3,4-dichloro-N-[(2-cyanophenyl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O2S/c22-20-11-10-19(12-21(20)23)28(26,27)25(14-16-6-2-1-3-7-16)15-18-9-5-4-8-17(18)13-24/h1-12H,14-15H2 |
| InChIKey | QYWOOMFQNNFYPH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |