C22H20ClN5O3S — CID 1177003
N-benzyl-N-[(2-chlorophenyl)methyl]-3-methoxy-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 1177003) has the molecular formula C22H20ClN5O3S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-benzyl-N-[(2-chlorophenyl)methyl]-3-methoxy-4-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | N-benzyl-N-[(2-chlorophenyl)methyl]-3-methoxy-4-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 1177003 |
| Molecular Formula | C22H20ClN5O3S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-benzyl-N-[(2-chlorophenyl)methyl]-3-methoxy-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C22H20ClN5O3S/c1-31-22-13-19(11-12-21(22)28-16-24-25-26-28)32(29,30)27(14-17-7-3-2-4-8-17)15-18-9-5-6-10-20(18)23/h2-13,16H,14-15H2,1H3 |
| InChIKey | SHHGZXWGVRUDQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |