C21H25ClN6O4S — CID 55774066
5-chloro-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 55774066) has the molecular formula C21H25ClN6O4S and a molecular weight of 492.99 g/mol. Its IUPAC name is 5-chloro-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55774066 |
| Molecular Formula | C21H25ClN6O4S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 5-chloro-N-[1-[4-(diethylsulfamoyl)phenyl]ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C)NC(=O)c2cc(Cl)c(-n3cnnn3)cc2OC)cc1 |
| InChI | InChI=1S/C21H25ClN6O4S/c1-5-27(6-2)33(30,31)16-9-7-15(8-10-16)14(3)24-21(29)17-11-18(22)19(12-20(17)32-4)28-13-23-25-26-28/h7-14H,5-6H2,1-4H3,(H,24,29) |
| InChIKey | DFSKAJUTHWGXLZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |