C17H17ClN6O5S — CID 55827929
5-chloro-N-[3-(methanesulfonamido)-4-methoxyphenyl]-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 55827929) has the molecular formula C17H17ClN6O5S and a molecular weight of 452.88 g/mol. Its IUPAC name is 5-chloro-N-[3-(methanesulfonamido)-4-methoxyphenyl]-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[3-(methanesulfonamido)-4-methoxyphenyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55827929 |
| Molecular Formula | C17H17ClN6O5S |
| Molecular Weight | 452.88 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-chloro-N-[3-(methanesulfonamido)-4-methoxyphenyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(Cl)c(-n3cnnn3)cc2OC)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H17ClN6O5S/c1-28-15-5-4-10(6-13(15)21-30(3,26)27)20-17(25)11-7-12(18)14(8-16(11)29-2)24-9-19-22-23-24/h4-9,21H,1-3H3,(H,20,25) |
| InChIKey | POCPACRHKNHBHA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.88 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |