C17H17ClN6O4S — CID 55776331
5-chloro-N-[[2-(methanesulfonamido)phenyl]methyl]-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 55776331) has the molecular formula C17H17ClN6O4S and a molecular weight of 436.88 g/mol. Its IUPAC name is 5-chloro-N-[[2-(methanesulfonamido)phenyl]methyl]-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[[2-(methanesulfonamido)phenyl]methyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55776331 |
| Molecular Formula | C17H17ClN6O4S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 5-chloro-N-[[2-(methanesulfonamido)phenyl]methyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)NCc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H17ClN6O4S/c1-28-16-8-15(24-10-20-22-23-24)13(18)7-12(16)17(25)19-9-11-5-3-4-6-14(11)21-29(2,26)27/h3-8,10,21H,9H2,1-2H3,(H,19,25) |
| InChIKey | AEQCBFWXBBGAGK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |