C17H19ClN6O3 — CID 87002077
5-chloro-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 87002077) has the molecular formula C17H19ClN6O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 87002077 |
| Molecular Formula | C17H19ClN6O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-chloro-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)NCC(c1ccco1)N(C)C |
| InChI | InChI=1S/C17H19ClN6O3/c1-23(2)14(15-5-4-6-27-15)9-19-17(25)11-7-12(18)13(8-16(11)26-3)24-10-20-21-22-24/h4-8,10,14H,9H2,1-3H3,(H,19,25) |
| InChIKey | JVMLWNHWYQYZCG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |