C15H18ClN5O3 — CID 52512620
5-chloro-2-methoxy-N-[2-[(2S)-oxolan-2-yl]ethyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 52512620) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[(2S)-oxolan-2-yl]ethyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[(2S)-oxolan-2-yl]ethyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 52512620 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[(2S)-oxolan-2-yl]ethyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)NCC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H18ClN5O3/c1-23-14-8-13(21-9-18-19-20-21)12(16)7-11(14)15(22)17-5-4-10-3-2-6-24-10/h7-10H,2-6H2,1H3,(H,17,22)/t10-/m0/s1 |
| InChIKey | FJBAHROLBQNKLF-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |