C19H16ClN5O2S — CID 87005767
N-[2-(1-benzothiophen-3-yl)ethyl]-5-chloro-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 87005767) has the molecular formula C19H16ClN5O2S and a molecular weight of 413.89 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-5-chloro-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-chloro-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 87005767 |
| Molecular Formula | C19H16ClN5O2S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-chloro-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)NCCc1csc2ccccc12 |
| InChI | InChI=1S/C19H16ClN5O2S/c1-27-17-9-16(25-11-22-23-24-25)15(20)8-14(17)19(26)21-7-6-12-10-28-18-5-3-2-4-13(12)18/h2-5,8-11H,6-7H2,1H3,(H,21,26) |
| InChIKey | WKTXFWYREXJCRR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |