C18H17NO3S — CID 87005563
N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxy-3-methoxybenzamide (PubChem CID 87005563) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 87005563 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCc2csc3ccccc23)c1O |
| InChI | InChI=1S/C18H17NO3S/c1-22-15-7-4-6-14(17(15)20)18(21)19-10-9-12-11-23-16-8-3-2-5-13(12)16/h2-8,11,20H,9-10H2,1H3,(H,19,21) |
| InChIKey | VJKDXFYRZMRMLJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |