C17H12ClF2NOS — CID 87005686
N-[2-(1-benzothiophen-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 87005686) has the molecular formula C17H12ClF2NOS and a molecular weight of 351.81 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 87005686 |
| Molecular Formula | C17H12ClF2NOS |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(NCCc1csc2ccccc12)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H12ClF2NOS/c18-13-8-15(20)14(19)7-12(13)17(22)21-6-5-10-9-23-16-4-2-1-3-11(10)16/h1-4,7-9H,5-6H2,(H,21,22) |
| InChIKey | QBLKSLXIHYTPND-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|