C13H15NO2S — CID 115139367
N-[2-(1-benzothiophen-3-yl)ethyl]-3-hydroxypropanamide (PubChem CID 115139367) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-3-hydroxypropanamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 115139367 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-3-hydroxypropanamide |
| SMILES | O=C(CCO)NCCc1csc2ccccc12 |
| InChI | InChI=1S/C13H15NO2S/c15-8-6-13(16)14-7-5-10-9-17-12-4-2-1-3-11(10)12/h1-4,9,15H,5-8H2,(H,14,16) |
| InChIKey | QDDBBULCMDKWFO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |