C20H20FNO2S — CID 112837134
N-[2-(1-benzothiophen-3-yl)ethyl]-4-(4-fluorophenoxy)butanamide (PubChem CID 112837134) has the molecular formula C20H20FNO2S and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-4-(4-fluorophenoxy)butanamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-4-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 112837134 |
| Molecular Formula | C20H20FNO2S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-4-(4-fluorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(F)cc1)NCCc1csc2ccccc12 |
| InChI | InChI=1S/C20H20FNO2S/c21-16-7-9-17(10-8-16)24-13-3-6-20(23)22-12-11-15-14-25-19-5-2-1-4-18(15)19/h1-2,4-5,7-10,14H,3,6,11-13H2,(H,22,23) |
| InChIKey | XAMYUUPNZFVVGP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|