C17H21NOS — CID 87005605
N-[2-(1-benzothiophen-3-yl)ethyl]cyclohexanecarboxamide (PubChem CID 87005605) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87005605 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1csc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C17H21NOS/c19-17(13-6-2-1-3-7-13)18-11-10-14-12-20-16-9-5-4-8-15(14)16/h4-5,8-9,12-13H,1-3,6-7,10-11H2,(H,18,19) |
| InChIKey | UURXSDVXDJWZEF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |