C18H19NO2S — CID 161370454
N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxybenzamide;methane (PubChem CID 161370454) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxybenzamide;methane.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxybenzamide;methane |
|---|---|
| PubChem CID | 161370454 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2-hydroxybenzamide;methane |
| SMILES | C.O=C(NCCc1csc2ccccc12)c1ccccc1O |
| InChI | InChI=1S/C17H15NO2S.CH4/c19-15-7-3-1-6-14(15)17(20)18-10-9-12-11-21-16-8-4-2-5-13(12)16;/h1-8,11,19H,9-10H2,(H,18,20);1H4 |
| InChIKey | VQJWBRMXEDMPMJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |