C17H11F4NOS — CID 112837021
N-[2-(1-benzothiophen-3-yl)ethyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 112837021) has the molecular formula C17H11F4NOS and a molecular weight of 353.34 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 112837021 |
| Molecular Formula | C17H11F4NOS |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(NCCc1csc2ccccc12)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H11F4NOS/c18-12-7-11(14(19)16(21)15(12)20)17(23)22-6-5-9-8-24-13-4-2-1-3-10(9)13/h1-4,7-8H,5-6H2,(H,22,23) |
| InChIKey | HDYNMYHNORSCID-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|