C17H15NO3S2 — CID 87020534
methyl 5-[2-(1-benzothiophen-3-yl)ethylcarbamoyl]thiophene-2-carboxylate (PubChem CID 87020534) has the molecular formula C17H15NO3S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is methyl 5-[2-(1-benzothiophen-3-yl)ethylcarbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[2-(1-benzothiophen-3-yl)ethylcarbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 87020534 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | methyl 5-[2-(1-benzothiophen-3-yl)ethylcarbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCCc2csc3ccccc23)s1 |
| InChI | InChI=1S/C17H15NO3S2/c1-21-17(20)15-7-6-14(23-15)16(19)18-9-8-11-10-22-13-5-3-2-4-12(11)13/h2-7,10H,8-9H2,1H3,(H,18,19) |
| InChIKey | UYZDNYOHGYIVCM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |