C17H13BrFNOS — CID 112836987
N-[2-(1-benzothiophen-3-yl)ethyl]-5-bromo-2-fluorobenzamide (PubChem CID 112836987) has the molecular formula C17H13BrFNOS and a molecular weight of 378.27 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)ethyl]-5-bromo-2-fluorobenzamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 112836987 |
| Molecular Formula | C17H13BrFNOS |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)ethyl]-5-bromo-2-fluorobenzamide |
| SMILES | O=C(NCCc1csc2ccccc12)c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H13BrFNOS/c18-12-5-6-15(19)14(9-12)17(21)20-8-7-11-10-22-16-4-2-1-3-13(11)16/h1-6,9-10H,7-8H2,(H,20,21) |
| InChIKey | VLVCPBZIVTWZQL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |