C17H14BrFN2OS — CID 46426520
N-[3-(1,3-benzothiazol-2-yl)propyl]-5-bromo-2-fluorobenzamide (PubChem CID 46426520) has the molecular formula C17H14BrFN2OS and a molecular weight of 393.28 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-5-bromo-2-fluorobenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 46426520 |
| Molecular Formula | C17H14BrFN2OS |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-bromo-2-fluorobenzamide |
| SMILES | O=C(NCCCc1nc2ccccc2s1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H14BrFN2OS/c18-11-7-8-13(19)12(10-11)17(22)20-9-3-6-16-21-14-4-1-2-5-15(14)23-16/h1-2,4-5,7-8,10H,3,6,9H2,(H,20,22) |
| InChIKey | CKNDNXAIMXDUSY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|