C15H11BrN2O2S — CID 43004261
N-(1,3-benzothiazol-2-ylmethyl)-5-bromo-2-hydroxybenzamide (PubChem CID 43004261) has the molecular formula C15H11BrN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-5-bromo-2-hydroxybenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 43004261 |
| Molecular Formula | C15H11BrN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-5-bromo-2-hydroxybenzamide |
| SMILES | O=C(NCc1nc2ccccc2s1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H11BrN2O2S/c16-9-5-6-12(19)10(7-9)15(20)17-8-14-18-11-3-1-2-4-13(11)21-14/h1-7,19H,8H2,(H,17,20) |
| InChIKey | WBQUCBVLTUOGSN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |