C17H16BrN3OS — CID 55748105
1-(1,3-benzothiazol-2-ylmethyl)-3-(4-bromo-2,6-dimethylphenyl)urea (PubChem CID 55748105) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-(4-bromo-2,6-dimethylphenyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-(4-bromo-2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 55748105 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-(4-bromo-2,6-dimethylphenyl)urea |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H16BrN3OS/c1-10-7-12(18)8-11(2)16(10)21-17(22)19-9-15-20-13-5-3-4-6-14(13)23-15/h3-8H,9H2,1-2H3,(H2,19,21,22) |
| InChIKey | QXYKVPICENVOII-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |