C16H15BrN2S — CID 107573635
N-(1,3-benzothiazol-2-ylmethyl)-4-bromo-3,5-dimethylaniline (PubChem CID 107573635) has the molecular formula C16H15BrN2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-bromo-3,5-dimethylaniline.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-bromo-3,5-dimethylaniline |
|---|---|
| PubChem CID | 107573635 |
| Molecular Formula | C16H15BrN2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-bromo-3,5-dimethylaniline |
| SMILES | Cc1cc(NCc2nc3ccccc3s2)cc(C)c1Br |
| InChI | InChI=1S/C16H15BrN2S/c1-10-7-12(8-11(2)16(10)17)18-9-15-19-13-5-3-4-6-14(13)20-15/h3-8,18H,9H2,1-2H3 |
| InChIKey | NTWOMCWXSLDWEK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |