C13H14N4S — CID 114253553
N-(1,3-benzothiazol-2-ylmethyl)-1,5-dimethylpyrazol-3-amine (PubChem CID 114253553) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-1,5-dimethylpyrazol-3-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-1,5-dimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 114253553 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-1,5-dimethylpyrazol-3-amine |
| SMILES | Cc1cc(NCc2nc3ccccc3s2)nn1C |
| InChI | InChI=1S/C13H14N4S/c1-9-7-12(16-17(9)2)14-8-13-15-10-5-3-4-6-11(10)18-13/h3-7H,8H2,1-2H3,(H,14,16) |
| InChIKey | MBTGKRREFLMWPB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |