C14H10Cl2N2S — CID 60671399
N-(1,3-benzothiazol-2-ylmethyl)-3,5-dichloroaniline (PubChem CID 60671399) has the molecular formula C14H10Cl2N2S and a molecular weight of 309.22 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3,5-dichloroaniline.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 60671399 |
| Molecular Formula | C14H10Cl2N2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3,5-dichloroaniline |
| SMILES | Clc1cc(Cl)cc(NCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H10Cl2N2S/c15-9-5-10(16)7-11(6-9)17-8-14-18-12-3-1-2-4-13(12)19-14/h1-7,17H,8H2 |
| InChIKey | QZDXSEQKSBHCEF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |