C15H10ClN3S — CID 107807802
4-(1,3-benzothiazol-2-ylmethylamino)-3-chlorobenzonitrile (PubChem CID 107807802) has the molecular formula C15H10ClN3S and a molecular weight of 299.79 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethylamino)-3-chlorobenzonitrile.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethylamino)-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 107807802 |
| Molecular Formula | C15H10ClN3S |
| Molecular Weight | 299.79 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethylamino)-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc(NCc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C15H10ClN3S/c16-11-7-10(8-17)5-6-12(11)18-9-15-19-13-3-1-2-4-14(13)20-15/h1-7,18H,9H2 |
| InChIKey | FXNHCVOCPIGIBU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |