C15H10BrN3S — CID 82708015
2-(1,3-benzothiazol-2-ylmethylamino)-5-bromobenzonitrile (PubChem CID 82708015) has the molecular formula C15H10BrN3S and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylamino)-5-bromobenzonitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylamino)-5-bromobenzonitrile |
|---|---|
| PubChem CID | 82708015 |
| Molecular Formula | C15H10BrN3S |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylamino)-5-bromobenzonitrile |
| SMILES | N#Cc1cc(Br)ccc1NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10BrN3S/c16-11-5-6-12(10(7-11)8-17)18-9-15-19-13-3-1-2-4-14(13)20-15/h1-7,18H,9H2 |
| InChIKey | ZKDSKWMOZYMYFL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |