C14H11IN2S — CID 60678883
N-(1,3-benzothiazol-2-ylmethyl)-2-iodoaniline (PubChem CID 60678883) has the molecular formula C14H11IN2S and a molecular weight of 366.23 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-iodoaniline.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-iodoaniline |
|---|---|
| PubChem CID | 60678883 |
| Molecular Formula | C14H11IN2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-iodoaniline |
| SMILES | Ic1ccccc1NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11IN2S/c15-10-5-1-2-6-11(10)16-9-14-17-12-7-3-4-8-13(12)18-14/h1-8,16H,9H2 |
| InChIKey | ZDRYKMIPSPAEAQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|